C18H25N3O6S4 — CID 87977909
2-[4-(dimethylsulfamoyl)-7-[5-(4-methylthiophen-2-yl)thiophen-2-yl]-1,1-dioxo-1,4-thiazepan-7-yl]-N-hydroxyacetamide (PubChem CID 87977909) has the molecular formula C18H25N3O6S4 and a molecular weight of 507.68 g/mol. Its IUPAC name is 2-[4-(dimethylsulfamoyl)-7-[5-(4-methylthiophen-2-yl)thiophen-2-yl]-1,1-dioxo-1,4-thiazepan-7-yl]-N-hydroxyacetamide.
| Compound Name | 2-[4-(dimethylsulfamoyl)-7-[5-(4-methylthiophen-2-yl)thiophen-2-yl]-1,1-dioxo-1,4-thiazepan-7-yl]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 87977909 |
| Molecular Formula | C18H25N3O6S4 |
| Molecular Weight | 507.68 g/mol |
| Exact Mass | 507.06 |
| IUPAC Name | 2-[4-(dimethylsulfamoyl)-7-[5-(4-methylthiophen-2-yl)thiophen-2-yl]-1,1-dioxo-1,4-thiazepan-7-yl]-N-hydroxyacetamide |
| SMILES | Cc1csc(-c2ccc(C3(CC(=O)NO)CCN(S(=O)(=O)N(C)C)CCS3(=O)=O)s2)c1 |
| InChI | InChI=1S/C18H25N3O6S4/c1-13-10-15(28-12-13)14-4-5-16(29-14)18(11-17(22)19-23)6-7-21(8-9-30(18,24)25)31(26,27)20(2)3/h4-5,10,12,23H,6-9,11H2,1-3H3,(H,19,22) |
| InChIKey | WSJGMBYBXPYMOK-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 124.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.68 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|