C19H28BrNO4 — CID 87978072
tert-butyl 4-[4-(2-bromo-2-ethoxyethyl)-2-formylanilino]butanoate (PubChem CID 87978072) has the molecular formula C19H28BrNO4 and a molecular weight of 414.34 g/mol. Its IUPAC name is tert-butyl 4-[4-(2-bromo-2-ethoxyethyl)-2-formylanilino]butanoate.
| Compound Name | tert-butyl 4-[4-(2-bromo-2-ethoxyethyl)-2-formylanilino]butanoate |
|---|---|
| PubChem CID | 87978072 |
| Molecular Formula | C19H28BrNO4 |
| Molecular Weight | 414.34 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | tert-butyl 4-[4-(2-bromo-2-ethoxyethyl)-2-formylanilino]butanoate |
| SMILES | CCOC(Br)Cc1ccc(NCCCC(=O)OC(C)(C)C)c(C=O)c1 |
| InChI | InChI=1S/C19H28BrNO4/c1-5-24-17(20)12-14-8-9-16(15(11-14)13-22)21-10-6-7-18(23)25-19(2,3)4/h8-9,11,13,17,21H,5-7,10,12H2,1-4H3 |
| InChIKey | NRNNMEPKCPHJDW-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.34 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|