C25H26O5S2 — CID 87978139
3-[5-[[2-methyl-5-[(3R,4R,5S,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]phenyl]methyl]thiophen-2-yl]benzaldehyde (PubChem CID 87978139) has the molecular formula C25H26O5S2 and a molecular weight of 470.61 g/mol. Its IUPAC name is 3-[5-[[2-methyl-5-[(3R,4R,5S,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]phenyl]methyl]thiophen-2-yl]benzaldehyde.
| Compound Name | 3-[5-[[2-methyl-5-[(3R,4R,5S,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]phenyl]methyl]thiophen-2-yl]benzaldehyde |
|---|---|
| PubChem CID | 87978139 |
| Molecular Formula | C25H26O5S2 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | 3-[5-[[2-methyl-5-[(3R,4R,5S,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]phenyl]methyl]thiophen-2-yl]benzaldehyde |
| SMILES | CS[C@H]1OC(c2ccc(C)c(Cc3ccc(-c4cccc(C=O)c4)s3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C25H26O5S2/c1-14-6-7-17(24-22(28)21(27)23(29)25(30-24)31-2)11-18(14)12-19-8-9-20(32-19)16-5-3-4-15(10-16)13-26/h3-11,13,21-25,27-29H,12H2,1-2H3/t21-,22-,23+,24?,25-/m1/s1 |
| InChIKey | MSYOXROPFXWPBG-FCQNWVOVSA-N |
| XLogP | 3.97 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|