About 2-oxo-1-benzazepine-3,4-dicarboxylic acid
2-oxo-1-benzazepine-3,4-dicarboxylic acid (PubChem CID 87978179) has the molecular formula C12H7NO5
and a molecular weight of 245.19 g/mol. Its IUPAC name is 2-oxo-1-benzazepine-3,4-dicarboxylic acid.
Molecular Properties
| Compound Name | 2-oxo-1-benzazepine-3,4-dicarboxylic acid |
| PubChem CID | 87978179 |
| Molecular Formula | C12H7NO5 |
| Molecular Weight | 245.19 g/mol |
| Exact Mass | 245.03 |
| IUPAC Name | 2-oxo-1-benzazepine-3,4-dicarboxylic acid |
| SMILES | O=C(O)c1cc2ccccc2nc(=O)c1C(=O)O |
| InChI | InChI=1S/C12H7NO5/c14-10-9(12(17)18)7(11(15)16)5-6-3-1-2-4-8(6)13-10/h1-5H,(H,15,16)(H,17,18) |
| InChIKey | VZDMHFCTEOEKOD-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 104.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.19 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-oxo-1-benzazepine-3,4-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-1-benzazepine-3,4-dicarboxylic acid?
The IUPAC name of 2-oxo-1-benzazepine-3,4-dicarboxylic acid (CID 87978179) is 2-oxo-1-benzazepine-3,4-dicarboxylic acid.
What is the SMILES notation for 2-oxo-1-benzazepine-3,4-dicarboxylic acid?
The canonical SMILES for 2-oxo-1-benzazepine-3,4-dicarboxylic acid is O=C(O)c1cc2ccccc2nc(=O)c1C(=O)O.
What is the InChIKey of 2-oxo-1-benzazepine-3,4-dicarboxylic acid?
The InChIKey is VZDMHFCTEOEKOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7NO5/c14-10-9(12(17)18)7(11(15)16)5-6-3-1-2-4-8(6)13-10/h1-5H,(H,15,16)(H,17,18).
What are the key properties of 2-oxo-1-benzazepine-3,4-dicarboxylic acid?
2-oxo-1-benzazepine-3,4-dicarboxylic acid has a molecular weight of 245.19 g/mol, XLogP of 0.99, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-1-benzazepine-3,4-dicarboxylic acid is sourced from PubChem (CID 87978179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).