C22H27NO6 — CID 87978470
(E)-1-(4-amino-3-ethoxyphenyl)-2-methyl-3-(2,3,4,5-tetramethoxyphenyl)prop-2-en-1-one (PubChem CID 87978470) has the molecular formula C22H27NO6 and a molecular weight of 401.46 g/mol. Its IUPAC name is (E)-1-(4-amino-3-ethoxyphenyl)-2-methyl-3-(2,3,4,5-tetramethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(4-amino-3-ethoxyphenyl)-2-methyl-3-(2,3,4,5-tetramethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 87978470 |
| Molecular Formula | C22H27NO6 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | (E)-1-(4-amino-3-ethoxyphenyl)-2-methyl-3-(2,3,4,5-tetramethoxyphenyl)prop-2-en-1-one |
| SMILES | CCOc1cc(C(=O)/C(C)=C/c2cc(OC)c(OC)c(OC)c2OC)ccc1N |
| InChI | InChI=1S/C22H27NO6/c1-7-29-17-11-14(8-9-16(17)23)19(24)13(2)10-15-12-18(25-3)21(27-5)22(28-6)20(15)26-4/h8-12H,7,23H2,1-6H3/b13-10+ |
| InChIKey | OAPRTPDQTNFESB-JLHYYAGUSA-N |
| XLogP | 3.99 |
| TPSA | 89.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|