C21H22BrNO5 — CID 87978601
(E)-2-bromo-1-[3-(dimethylamino)-4-methoxyphenyl]-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-en-1-one (PubChem CID 87978601) has the molecular formula C21H22BrNO5 and a molecular weight of 448.31 g/mol. Its IUPAC name is (E)-2-bromo-1-[3-(dimethylamino)-4-methoxyphenyl]-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-en-1-one.
| Compound Name | (E)-2-bromo-1-[3-(dimethylamino)-4-methoxyphenyl]-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 87978601 |
| Molecular Formula | C21H22BrNO5 |
| Molecular Weight | 448.31 g/mol |
| Exact Mass | 447.07 |
| IUPAC Name | (E)-2-bromo-1-[3-(dimethylamino)-4-methoxyphenyl]-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)/C(Br)=C\c2ccc3c(c2OC)OCCO3)cc1N(C)C |
| InChI | InChI=1S/C21H22BrNO5/c1-23(2)16-12-13(5-7-17(16)25-3)19(24)15(22)11-14-6-8-18-21(20(14)26-4)28-10-9-27-18/h5-8,11-12H,9-10H2,1-4H3/b15-11+ |
| InChIKey | DMHOOESAZKPKTK-RVDMUPIBSA-N |
| XLogP | 4.16 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.31 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|