About dichlorozirconium;7-[(3,7-dimethyl-3H-inden-4-yl)methyl]-1,4-dimethyl-1H-indene
dichlorozirconium;7-[(3,7-dimethyl-3H-inden-4-yl)methyl]-1,4-dimethyl-1H-indene (PubChem CID 87978672) has the molecular formula C23H23Cl2Zr-
and a molecular weight of 461.57 g/mol. Its IUPAC name is dichlorozirconium;7-[(3,7-dimethyl-3H-inden-4-yl)methyl]-1,4-dimethyl-1H-indene.
Molecular Properties
| Compound Name | dichlorozirconium;7-[(3,7-dimethyl-3H-inden-4-yl)methyl]-1,4-dimethyl-1H-indene |
| PubChem CID | 87978672 |
| Molecular Formula | C23H23Cl2Zr- |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 459.02 |
| IUPAC Name | dichlorozirconium;7-[(3,7-dimethyl-3H-inden-4-yl)methyl]-1,4-dimethyl-1H-indene |
| SMILES | Cc1ccc([CH-]c2ccc(C)c3c2C(C)C=C3)c2c1C=CC2C.Cl[Zr]Cl |
| InChI | InChI=1S/C23H23.2ClH.Zr/c1-14-5-9-18(22-16(3)7-11-20(14)22)13-19-10-6-15(2)21-12-8-17(4)23(19)21;;;/h5-13,16-17H,1-4H3;2*1H;/q-1;;;+2/p-2 |
| InChIKey | MNYFTPSQCDQNCW-UHFFFAOYSA-L |
| XLogP | 7.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze dichlorozirconium;7-[(3,7-dimethyl-3H-inden-4-yl)methyl]-1,4-dimethyl-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorozirconium;7-[(3,7-dimethyl-3H-inden-4-yl)methyl]-1,4-dimethyl-1H-indene?
The IUPAC name of dichlorozirconium;7-[(3,7-dimethyl-3H-inden-4-yl)methyl]-1,4-dimethyl-1H-indene (CID 87978672) is dichlorozirconium;7-[(3,7-dimethyl-3H-inden-4-yl)methyl]-1,4-dimethyl-1H-indene.
What is the SMILES notation for dichlorozirconium;7-[(3,7-dimethyl-3H-inden-4-yl)methyl]-1,4-dimethyl-1H-indene?
The canonical SMILES for dichlorozirconium;7-[(3,7-dimethyl-3H-inden-4-yl)methyl]-1,4-dimethyl-1H-indene is Cc1ccc([CH-]c2ccc(C)c3c2C(C)C=C3)c2c1C=CC2C.Cl[Zr]Cl.
What is the InChIKey of dichlorozirconium;7-[(3,7-dimethyl-3H-inden-4-yl)methyl]-1,4-dimethyl-1H-indene?
The InChIKey is MNYFTPSQCDQNCW-UHFFFAOYSA-L. The full InChI is InChI=1S/C23H23.2ClH.Zr/c1-14-5-9-18(22-16(3)7-11-20(14)22)13-19-10-6-15(2)21-12-8-17(4)23(19)21;;;/h5-13,16-17H,1-4H3;2*1H;/q-1;;;+2/p-2.
What are the key properties of dichlorozirconium;7-[(3,7-dimethyl-3H-inden-4-yl)methyl]-1,4-dimethyl-1H-indene?
dichlorozirconium;7-[(3,7-dimethyl-3H-inden-4-yl)methyl]-1,4-dimethyl-1H-indene has a molecular weight of 461.57 g/mol, XLogP of 7.54, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorozirconium;7-[(3,7-dimethyl-3H-inden-4-yl)methyl]-1,4-dimethyl-1H-indene is sourced from PubChem (CID 87978672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).