C11H15Cl2OTi- — CID 87978911
carbonyl dichloride;1,2,3,5,5-pentamethylcyclopenta-1,3-diene;titanium (PubChem CID 87978911) has the molecular formula C11H15Cl2OTi- and a molecular weight of 282.01 g/mol. Its IUPAC name is carbonyl dichloride;1,2,3,5,5-pentamethylcyclopenta-1,3-diene;titanium.
| Compound Name | carbonyl dichloride;1,2,3,5,5-pentamethylcyclopenta-1,3-diene;titanium |
|---|---|
| PubChem CID | 87978911 |
| Molecular Formula | C11H15Cl2OTi- |
| Molecular Weight | 282.01 g/mol |
| Exact Mass | 281.00 |
| IUPAC Name | carbonyl dichloride;1,2,3,5,5-pentamethylcyclopenta-1,3-diene;titanium |
| SMILES | CC1=[C-]C(C)(C)C(C)=C1C.O=C(Cl)Cl.[Ti] |
| InChI | InChI=1S/C10H15.CCl2O.Ti/c1-7-6-10(4,5)9(3)8(7)2;2-1(3)4;/h1-5H3;;/q-1;; |
| InChIKey | BLOBBTNZJMVGCU-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.01 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|