C29H34ClF6N3O5 — CID 87979240
1-[3a-(3,4-dimethoxyphenyl)-1-propan-2-yl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-[3-chloro-4-(trifluoromethyl)phenyl]urea;2,2,2-trifluoroacetic acid (PubChem CID 87979240) has the molecular formula C29H34ClF6N3O5 and a molecular weight of 654.05 g/mol. Its IUPAC name is 1-[3a-(3,4-dimethoxyphenyl)-1-propan-2-yl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-[3-chloro-4-(trifluoromethyl)phenyl]urea;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[3a-(3,4-dimethoxyphenyl)-1-propan-2-yl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-[3-chloro-4-(trifluoromethyl)phenyl]urea;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 87979240 |
| Molecular Formula | C29H34ClF6N3O5 |
| Molecular Weight | 654.05 g/mol |
| Exact Mass | 653.21 |
| IUPAC Name | 1-[3a-(3,4-dimethoxyphenyl)-1-propan-2-yl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-[3-chloro-4-(trifluoromethyl)phenyl]urea;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc(C23CCC(NC(=O)Nc4ccc(C(F)(F)F)c(Cl)c4)CC2N(C(C)C)CC3)cc1OC.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C27H33ClF3N3O3.C2HF3O2/c1-16(2)34-12-11-26(17-5-8-22(36-3)23(13-17)37-4)10-9-19(15-24(26)34)33-25(35)32-18-6-7-20(21(28)14-18)27(29,30)31;3-2(4,5)1(6)7/h5-8,13-14,16,19,24H,9-12,15H2,1-4H3,(H2,32,33,35);(H,6,7) |
| InChIKey | JPXWZQHMMNQAGQ-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.05 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |