C26H39N3O7S — CID 87979284
[(1R,2R)-2-hydroxycyclohexyl] 4-(hydroxycarbamoyl)-4-[[4-(2-methylphenyl)piperidin-1-yl]sulfonylmethyl]piperidine-1-carboxylate (PubChem CID 87979284) has the molecular formula C26H39N3O7S and a molecular weight of 537.68 g/mol. Its IUPAC name is [(1R,2R)-2-hydroxycyclohexyl] 4-(hydroxycarbamoyl)-4-[[4-(2-methylphenyl)piperidin-1-yl]sulfonylmethyl]piperidine-1-carboxylate.
| Compound Name | [(1R,2R)-2-hydroxycyclohexyl] 4-(hydroxycarbamoyl)-4-[[4-(2-methylphenyl)piperidin-1-yl]sulfonylmethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 87979284 |
| Molecular Formula | C26H39N3O7S |
| Molecular Weight | 537.68 g/mol |
| Exact Mass | 537.25 |
| IUPAC Name | [(1R,2R)-2-hydroxycyclohexyl] 4-(hydroxycarbamoyl)-4-[[4-(2-methylphenyl)piperidin-1-yl]sulfonylmethyl]piperidine-1-carboxylate |
| SMILES | Cc1ccccc1C1CCN(S(=O)(=O)CC2(C(=O)NO)CCN(C(=O)O[C@@H]3CCCC[C@H]3O)CC2)CC1 |
| InChI | InChI=1S/C26H39N3O7S/c1-19-6-2-3-7-21(19)20-10-14-29(15-11-20)37(34,35)18-26(24(31)27-33)12-16-28(17-13-26)25(32)36-23-9-5-4-8-22(23)30/h2-3,6-7,20,22-23,30,33H,4-5,8-18H2,1H3,(H,27,31)/t22-,23-/m1/s1 |
| InChIKey | JCWHSASAMUTOIR-DHIUTWEWSA-N |
| XLogP | 2.53 |
| TPSA | 136.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.68 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|