About 4-[3,5-dimethyl-4-[2-(oxiran-2-yl)propan-2-yloxy]phenyl]-2,6-dimethylphenol
4-[3,5-dimethyl-4-[2-(oxiran-2-yl)propan-2-yloxy]phenyl]-2,6-dimethylphenol (PubChem CID 87979596) has the molecular formula C21H26O3
and a molecular weight of 326.44 g/mol. Its IUPAC name is 4-[3,5-dimethyl-4-[2-(oxiran-2-yl)propan-2-yloxy]phenyl]-2,6-dimethylphenol.
Molecular Properties
| Compound Name | 4-[3,5-dimethyl-4-[2-(oxiran-2-yl)propan-2-yloxy]phenyl]-2,6-dimethylphenol |
| PubChem CID | 87979596 |
| Molecular Formula | C21H26O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | 4-[3,5-dimethyl-4-[2-(oxiran-2-yl)propan-2-yloxy]phenyl]-2,6-dimethylphenol |
| SMILES | Cc1cc(-c2cc(C)c(OC(C)(C)C3CO3)c(C)c2)cc(C)c1O |
| InChI | InChI=1S/C21H26O3/c1-12-7-16(8-13(2)19(12)22)17-9-14(3)20(15(4)10-17)24-21(5,6)18-11-23-18/h7-10,18,22H,11H2,1-6H3 |
| InChIKey | FEZWBNXXXPDDNF-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 4-[3,5-dimethyl-4-[2-(oxiran-2-yl)propan-2-yloxy]phenyl]-2,6-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3,5-dimethyl-4-[2-(oxiran-2-yl)propan-2-yloxy]phenyl]-2,6-dimethylphenol?
The IUPAC name of 4-[3,5-dimethyl-4-[2-(oxiran-2-yl)propan-2-yloxy]phenyl]-2,6-dimethylphenol (CID 87979596) is 4-[3,5-dimethyl-4-[2-(oxiran-2-yl)propan-2-yloxy]phenyl]-2,6-dimethylphenol.
What is the SMILES notation for 4-[3,5-dimethyl-4-[2-(oxiran-2-yl)propan-2-yloxy]phenyl]-2,6-dimethylphenol?
The canonical SMILES for 4-[3,5-dimethyl-4-[2-(oxiran-2-yl)propan-2-yloxy]phenyl]-2,6-dimethylphenol is Cc1cc(-c2cc(C)c(OC(C)(C)C3CO3)c(C)c2)cc(C)c1O.
What is the InChIKey of 4-[3,5-dimethyl-4-[2-(oxiran-2-yl)propan-2-yloxy]phenyl]-2,6-dimethylphenol?
The InChIKey is FEZWBNXXXPDDNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26O3/c1-12-7-16(8-13(2)19(12)22)17-9-14(3)20(15(4)10-17)24-21(5,6)18-11-23-18/h7-10,18,22H,11H2,1-6H3.
What are the key properties of 4-[3,5-dimethyl-4-[2-(oxiran-2-yl)propan-2-yloxy]phenyl]-2,6-dimethylphenol?
4-[3,5-dimethyl-4-[2-(oxiran-2-yl)propan-2-yloxy]phenyl]-2,6-dimethylphenol has a molecular weight of 326.44 g/mol, XLogP of 4.85, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3,5-dimethyl-4-[2-(oxiran-2-yl)propan-2-yloxy]phenyl]-2,6-dimethylphenol is sourced from PubChem (CID 87979596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).