About (16R)-16-[tert-butyl(dimethyl)silyl]oxyicosa-5,14-diyn-1-ol
(16R)-16-[tert-butyl(dimethyl)silyl]oxyicosa-5,14-diyn-1-ol (PubChem CID 87979847) has the molecular formula C26H48O2Si
and a molecular weight of 420.75 g/mol. Its IUPAC name is (16R)-16-[tert-butyl(dimethyl)silyl]oxyicosa-5,14-diyn-1-ol.
Molecular Properties
| Compound Name | (16R)-16-[tert-butyl(dimethyl)silyl]oxyicosa-5,14-diyn-1-ol |
| PubChem CID | 87979847 |
| Molecular Formula | C26H48O2Si |
| Molecular Weight | 420.75 g/mol |
| Exact Mass | 420.34 |
| IUPAC Name | (16R)-16-[tert-butyl(dimethyl)silyl]oxyicosa-5,14-diyn-1-ol |
| SMILES | CCCC[C@H](C#CCCCCCCCC#CCCCCO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H48O2Si/c1-7-8-22-25(28-29(5,6)26(2,3)4)23-20-18-16-14-12-10-9-11-13-15-17-19-21-24-27/h25,27H,7-12,14,16-19,21-22,24H2,1-6H3/t25-/m1/s1 |
| InChIKey | MGTQHSGLMWGHSE-RUZDIDTESA-N |
| XLogP | 7.47 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.75 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (16R)-16-[tert-butyl(dimethyl)silyl]oxyicosa-5,14-diyn-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (16R)-16-[tert-butyl(dimethyl)silyl]oxyicosa-5,14-diyn-1-ol?
The IUPAC name of (16R)-16-[tert-butyl(dimethyl)silyl]oxyicosa-5,14-diyn-1-ol (CID 87979847) is (16R)-16-[tert-butyl(dimethyl)silyl]oxyicosa-5,14-diyn-1-ol.
What is the SMILES notation for (16R)-16-[tert-butyl(dimethyl)silyl]oxyicosa-5,14-diyn-1-ol?
The canonical SMILES for (16R)-16-[tert-butyl(dimethyl)silyl]oxyicosa-5,14-diyn-1-ol is CCCC[C@H](C#CCCCCCCCC#CCCCCO)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of (16R)-16-[tert-butyl(dimethyl)silyl]oxyicosa-5,14-diyn-1-ol?
The InChIKey is MGTQHSGLMWGHSE-RUZDIDTESA-N. The full InChI is InChI=1S/C26H48O2Si/c1-7-8-22-25(28-29(5,6)26(2,3)4)23-20-18-16-14-12-10-9-11-13-15-17-19-21-24-27/h25,27H,7-12,14,16-19,21-22,24H2,1-6H3/t25-/m1/s1.
What are the key properties of (16R)-16-[tert-butyl(dimethyl)silyl]oxyicosa-5,14-diyn-1-ol?
(16R)-16-[tert-butyl(dimethyl)silyl]oxyicosa-5,14-diyn-1-ol has a molecular weight of 420.75 g/mol, XLogP of 7.47, 14 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (16R)-16-[tert-butyl(dimethyl)silyl]oxyicosa-5,14-diyn-1-ol is sourced from PubChem (CID 87979847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).