C5H5N3O3S — CID 8798
N-(5-nitro-1,3-thiazol-2-yl)acetamide (PubChem CID 8798) has the molecular formula C5H5N3O3S and a molecular weight of 187.18 g/mol. Its IUPAC name is N-(5-nitro-1,3-thiazol-2-yl)acetamide.
| Compound Name | N-(5-nitro-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 8798 |
| Molecular Formula | C5H5N3O3S |
| Molecular Weight | 187.18 g/mol |
| Exact Mass | 187.01 |
| IUPAC Name | N-(5-nitro-1,3-thiazol-2-yl)acetamide |
| SMILES | CC(=O)Nc1ncc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C5H5N3O3S/c1-3(9)7-5-6-2-4(12-5)8(10)11/h2H,1H3,(H,6,7,9) |
| InChIKey | UJRRDDHEMZLWFI-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.18 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|