C27H30F7N3O5 — CID 87980620
1-[(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-[2-fluoro-5-(trifluoromethyl)phenyl]urea;2,2,2-trifluoroacetic acid (PubChem CID 87980620) has the molecular formula C27H30F7N3O5 and a molecular weight of 609.54 g/mol. Its IUPAC name is 1-[(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-[2-fluoro-5-(trifluoromethyl)phenyl]urea;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-[2-fluoro-5-(trifluoromethyl)phenyl]urea;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 87980620 |
| Molecular Formula | C27H30F7N3O5 |
| Molecular Weight | 609.54 g/mol |
| Exact Mass | 609.21 |
| IUPAC Name | 1-[(3aS,6R,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-[2-fluoro-5-(trifluoromethyl)phenyl]urea;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc([C@@]23CC[C@@H](NC(=O)Nc4cc(C(F)(F)F)ccc4F)C[C@@H]2N(C)CC3)cc1OC.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H29F4N3O3.C2HF3O2/c1-32-11-10-24(15-5-7-20(34-2)21(13-15)35-3)9-8-17(14-22(24)32)30-23(33)31-19-12-16(25(27,28)29)4-6-18(19)26;3-2(4,5)1(6)7/h4-7,12-13,17,22H,8-11,14H2,1-3H3,(H2,30,31,33);(H,6,7)/t17-,22+,24+;/m1./s1 |
| InChIKey | ULLIUCZKHUCKLG-HVTMGHLQSA-N |
| XLogP | 5.81 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.54 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |