C30H35F6N3O6 — CID 87980915
1-[3a-(3,4-dimethoxyphenyl)-1-(oxan-4-yl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(2,3,4-trifluorophenyl)urea;2,2,2-trifluoroacetic acid (PubChem CID 87980915) has the molecular formula C30H35F6N3O6 and a molecular weight of 647.61 g/mol. Its IUPAC name is 1-[3a-(3,4-dimethoxyphenyl)-1-(oxan-4-yl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(2,3,4-trifluorophenyl)urea;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[3a-(3,4-dimethoxyphenyl)-1-(oxan-4-yl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(2,3,4-trifluorophenyl)urea;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 87980915 |
| Molecular Formula | C30H35F6N3O6 |
| Molecular Weight | 647.61 g/mol |
| Exact Mass | 647.24 |
| IUPAC Name | 1-[3a-(3,4-dimethoxyphenyl)-1-(oxan-4-yl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-(2,3,4-trifluorophenyl)urea;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc(C23CCC(NC(=O)Nc4ccc(F)c(F)c4F)CC2N(C2CCOCC2)CC3)cc1OC.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C28H34F3N3O4.C2HF3O2/c1-36-22-6-3-17(15-23(22)37-2)28-10-7-18(16-24(28)34(12-11-28)19-8-13-38-14-9-19)32-27(35)33-21-5-4-20(29)25(30)26(21)31;3-2(4,5)1(6)7/h3-6,15,18-19,24H,7-14,16H2,1-2H3,(H2,32,33,35);(H,6,7) |
| InChIKey | XEDFBEULTDCBNY-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.61 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|