C27H22ClFN4O8S3 — CID 87981135
[2-amino-1-[(6-chloro-1-benzothiophen-2-yl)sulfonyl-[(3S)-1-[2-fluoro-4-(2-sulfamoylphenyl)phenyl]-2-oxopyrrolidin-3-yl]amino]-2-oxoethyl] formate (PubChem CID 87981135) has the molecular formula C27H22ClFN4O8S3 and a molecular weight of 681.15 g/mol. Its IUPAC name is [2-amino-1-[(6-chloro-1-benzothiophen-2-yl)sulfonyl-[(3S)-1-[2-fluoro-4-(2-sulfamoylphenyl)phenyl]-2-oxopyrrolidin-3-yl]amino]-2-oxoethyl] formate.
| Compound Name | [2-amino-1-[(6-chloro-1-benzothiophen-2-yl)sulfonyl-[(3S)-1-[2-fluoro-4-(2-sulfamoylphenyl)phenyl]-2-oxopyrrolidin-3-yl]amino]-2-oxoethyl] formate |
|---|---|
| PubChem CID | 87981135 |
| Molecular Formula | C27H22ClFN4O8S3 |
| Molecular Weight | 681.15 g/mol |
| Exact Mass | 680.03 |
| IUPAC Name | [2-amino-1-[(6-chloro-1-benzothiophen-2-yl)sulfonyl-[(3S)-1-[2-fluoro-4-(2-sulfamoylphenyl)phenyl]-2-oxopyrrolidin-3-yl]amino]-2-oxoethyl] formate |
| SMILES | NC(=O)C(OC=O)N([C@H]1CCN(c2ccc(-c3ccccc3S(N)(=O)=O)cc2F)C1=O)S(=O)(=O)c1cc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C27H22ClFN4O8S3/c28-17-7-5-16-12-24(42-22(16)13-17)44(39,40)33(27(25(30)35)41-14-34)21-9-10-32(26(21)36)20-8-6-15(11-19(20)29)18-3-1-2-4-23(18)43(31,37)38/h1-8,11-14,21,27H,9-10H2,(H2,30,35)(H2,31,37,38)/t21-,27?/m0/s1 |
| InChIKey | KCTOZWZAFMRXIW-LWAJAQLZSA-N |
| XLogP | 2.79 |
| TPSA | 187.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.15 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|