C19H13Cl2N5O2 — CID 87981273
(2Z,4E)-N-(2-cyanopyrimidin-5-yl)-5-(5,6-dichloro-1H-indol-2-yl)-2-methoxypenta-2,4-dienamide (PubChem CID 87981273) has the molecular formula C19H13Cl2N5O2 and a molecular weight of 414.25 g/mol. Its IUPAC name is (2Z,4E)-N-(2-cyanopyrimidin-5-yl)-5-(5,6-dichloro-1H-indol-2-yl)-2-methoxypenta-2,4-dienamide.
| Compound Name | (2Z,4E)-N-(2-cyanopyrimidin-5-yl)-5-(5,6-dichloro-1H-indol-2-yl)-2-methoxypenta-2,4-dienamide |
|---|---|
| PubChem CID | 87981273 |
| Molecular Formula | C19H13Cl2N5O2 |
| Molecular Weight | 414.25 g/mol |
| Exact Mass | 413.04 |
| IUPAC Name | (2Z,4E)-N-(2-cyanopyrimidin-5-yl)-5-(5,6-dichloro-1H-indol-2-yl)-2-methoxypenta-2,4-dienamide |
| SMILES | CO/C(=C\C=C\c1cc2cc(Cl)c(Cl)cc2[nH]1)C(=O)Nc1cnc(C#N)nc1 |
| InChI | InChI=1S/C19H13Cl2N5O2/c1-28-17(19(27)26-13-9-23-18(8-22)24-10-13)4-2-3-12-5-11-6-14(20)15(21)7-16(11)25-12/h2-7,9-10,25H,1H3,(H,26,27)/b3-2+,17-4- |
| InChIKey | QSSFADMQINTTOP-FKJKDRHESA-N |
| XLogP | 4.32 |
| TPSA | 103.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.25 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|