C31H52O4 — CID 87981706
(1R,2R,3R,5Z)-5-[2-[(1R,7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-(4-hydroxybutyl)-4-methylidenecyclohexane-1,3-diol (PubChem CID 87981706) has the molecular formula C31H52O4 and a molecular weight of 488.75 g/mol. Its IUPAC name is (1R,2R,3R,5Z)-5-[2-[(1R,7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-(4-hydroxybutyl)-4-methylidenecyclohexane-1,3-diol.
| Compound Name | (1R,2R,3R,5Z)-5-[2-[(1R,7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-(4-hydroxybutyl)-4-methylidenecyclohexane-1,3-diol |
|---|---|
| PubChem CID | 87981706 |
| Molecular Formula | C31H52O4 |
| Molecular Weight | 488.75 g/mol |
| Exact Mass | 488.39 |
| IUPAC Name | (1R,2R,3R,5Z)-5-[2-[(1R,7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-(4-hydroxybutyl)-4-methylidenecyclohexane-1,3-diol |
| SMILES | C=C1/C(=C\C=C2CCC[C@@]3(C)C2CC[C@@H]3[C@H](C)CCCC(C)(C)O)C[C@@H](O)[C@@H](CCCCO)[C@H]1O |
| InChI | InChI=1S/C31H52O4/c1-21(10-8-17-30(3,4)35)26-15-16-27-23(11-9-18-31(26,27)5)13-14-24-20-28(33)25(12-6-7-19-32)29(34)22(24)2/h13-14,21,25-29,32-35H,2,6-12,15-20H2,1,3-5H3/b23-13?,24-14-/t21-,25-,26-,27?,28-,29+,31-/m1/s1 |
| InChIKey | BCDZYLNIANLXGJ-CDZQQPBUSA-N |
| XLogP | 6.09 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.75 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|