C19H17N5O2S — CID 87981733
4-[[4-[cyano-(4-phenyl-3H-1,3-thiazol-2-ylidene)methyl]pyrimidin-2-yl]amino]butanoic acid (PubChem CID 87981733) has the molecular formula C19H17N5O2S and a molecular weight of 379.45 g/mol. Its IUPAC name is 4-[[4-[cyano-(4-phenyl-3H-1,3-thiazol-2-ylidene)methyl]pyrimidin-2-yl]amino]butanoic acid.
| Compound Name | 4-[[4-[cyano-(4-phenyl-3H-1,3-thiazol-2-ylidene)methyl]pyrimidin-2-yl]amino]butanoic acid |
|---|---|
| PubChem CID | 87981733 |
| Molecular Formula | C19H17N5O2S |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 4-[[4-[cyano-(4-phenyl-3H-1,3-thiazol-2-ylidene)methyl]pyrimidin-2-yl]amino]butanoic acid |
| SMILES | N#CC(=C1NC(c2ccccc2)=CS1)c1ccnc(NCCCC(=O)O)n1 |
| InChI | InChI=1S/C19H17N5O2S/c20-11-14(18-23-16(12-27-18)13-5-2-1-3-6-13)15-8-10-22-19(24-15)21-9-4-7-17(25)26/h1-3,5-6,8,10,12,23H,4,7,9H2,(H,25,26)(H,21,22,24) |
| InChIKey | GJJXFLNPANWVHI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 110.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|