C20H25N4O3+ — CID 87981781
5-[2-ethyl-2-(oxan-4-yl)pyrazol-2-ium-3-yl]-3-[(4-methoxyphenyl)methyl]-1,2,4-oxadiazole (PubChem CID 87981781) has the molecular formula C20H25N4O3+ and a molecular weight of 369.45 g/mol. Its IUPAC name is 5-[2-ethyl-2-(oxan-4-yl)pyrazol-2-ium-3-yl]-3-[(4-methoxyphenyl)methyl]-1,2,4-oxadiazole.
| Compound Name | 5-[2-ethyl-2-(oxan-4-yl)pyrazol-2-ium-3-yl]-3-[(4-methoxyphenyl)methyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 87981781 |
| Molecular Formula | C20H25N4O3+ |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 5-[2-ethyl-2-(oxan-4-yl)pyrazol-2-ium-3-yl]-3-[(4-methoxyphenyl)methyl]-1,2,4-oxadiazole |
| SMILES | CC[N+]1(C2CCOCC2)N=CC=C1c1nc(Cc2ccc(OC)cc2)no1 |
| InChI | InChI=1S/C20H25N4O3/c1-3-24(16-9-12-26-13-10-16)18(8-11-21-24)20-22-19(23-27-20)14-15-4-6-17(25-2)7-5-15/h4-8,11,16H,3,9-10,12-14H2,1-2H3/q+1 |
| InChIKey | CRINTIAZIYVKNF-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 69.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|