C18H24Cl2Ti — CID 87981970
1-chloro-4-[2-(4-chloro-2,3,5-trimethylcyclopenta-1,3-dien-1-yl)ethyl]-2,3,5-trimethylcyclopenta-1,3-diene;titanium (PubChem CID 87981970) has the molecular formula C18H24Cl2Ti and a molecular weight of 359.16 g/mol. Its IUPAC name is 1-chloro-4-[2-(4-chloro-2,3,5-trimethylcyclopenta-1,3-dien-1-yl)ethyl]-2,3,5-trimethylcyclopenta-1,3-diene;titanium.
| Compound Name | 1-chloro-4-[2-(4-chloro-2,3,5-trimethylcyclopenta-1,3-dien-1-yl)ethyl]-2,3,5-trimethylcyclopenta-1,3-diene;titanium |
|---|---|
| PubChem CID | 87981970 |
| Molecular Formula | C18H24Cl2Ti |
| Molecular Weight | 359.16 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | 1-chloro-4-[2-(4-chloro-2,3,5-trimethylcyclopenta-1,3-dien-1-yl)ethyl]-2,3,5-trimethylcyclopenta-1,3-diene;titanium |
| SMILES | CC1=C(Cl)C(C)C(CCC2=C(C)C(C)=C(Cl)C2C)=C1C.[Ti] |
| InChI | InChI=1S/C18H24Cl2.Ti/c1-9-11(3)17(19)13(5)15(9)7-8-16-10(2)12(4)18(20)14(16)6;/h13-14H,7-8H2,1-6H3; |
| InChIKey | RIZHVKHBBNBKMI-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.16 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |