About 1,5-bis[ethyl(dimethyl)silyl]penta-1,4-diyn-3-one
1,5-bis[ethyl(dimethyl)silyl]penta-1,4-diyn-3-one (PubChem CID 87982054) has the molecular formula C13H22OSi2
and a molecular weight of 250.49 g/mol. Its IUPAC name is 1,5-bis[ethyl(dimethyl)silyl]penta-1,4-diyn-3-one.
Molecular Properties
| Compound Name | 1,5-bis[ethyl(dimethyl)silyl]penta-1,4-diyn-3-one |
| PubChem CID | 87982054 |
| Molecular Formula | C13H22OSi2 |
| Molecular Weight | 250.49 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 1,5-bis[ethyl(dimethyl)silyl]penta-1,4-diyn-3-one |
| SMILES | CC[Si](C)(C)C#CC(=O)C#C[Si](C)(C)CC |
| InChI | InChI=1S/C13H22OSi2/c1-7-15(3,4)11-9-13(14)10-12-16(5,6)8-2/h7-8H2,1-6H3 |
| InChIKey | NCNJPBXABDZZGL-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.49 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_yne_A(1)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,5-bis[ethyl(dimethyl)silyl]penta-1,4-diyn-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-bis[ethyl(dimethyl)silyl]penta-1,4-diyn-3-one?
The IUPAC name of 1,5-bis[ethyl(dimethyl)silyl]penta-1,4-diyn-3-one (CID 87982054) is 1,5-bis[ethyl(dimethyl)silyl]penta-1,4-diyn-3-one.
What is the SMILES notation for 1,5-bis[ethyl(dimethyl)silyl]penta-1,4-diyn-3-one?
The canonical SMILES for 1,5-bis[ethyl(dimethyl)silyl]penta-1,4-diyn-3-one is CC[Si](C)(C)C#CC(=O)C#C[Si](C)(C)CC.
What is the InChIKey of 1,5-bis[ethyl(dimethyl)silyl]penta-1,4-diyn-3-one?
The InChIKey is NCNJPBXABDZZGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22OSi2/c1-7-15(3,4)11-9-13(14)10-12-16(5,6)8-2/h7-8H2,1-6H3.
What are the key properties of 1,5-bis[ethyl(dimethyl)silyl]penta-1,4-diyn-3-one?
1,5-bis[ethyl(dimethyl)silyl]penta-1,4-diyn-3-one has a molecular weight of 250.49 g/mol, XLogP of 3.10, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-bis[ethyl(dimethyl)silyl]penta-1,4-diyn-3-one is sourced from PubChem (CID 87982054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).