C26H31F3N4O4S — CID 87982067
(2R)-2-[cyanomethyl-[2,2,2-trifluoro-1-[4-(4-morpholin-2-ylsulfonylphenyl)phenyl]ethyl]amino]-4-methylpentanamide (PubChem CID 87982067) has the molecular formula C26H31F3N4O4S and a molecular weight of 552.62 g/mol. Its IUPAC name is (2R)-2-[cyanomethyl-[2,2,2-trifluoro-1-[4-(4-morpholin-2-ylsulfonylphenyl)phenyl]ethyl]amino]-4-methylpentanamide.
| Compound Name | (2R)-2-[cyanomethyl-[2,2,2-trifluoro-1-[4-(4-morpholin-2-ylsulfonylphenyl)phenyl]ethyl]amino]-4-methylpentanamide |
|---|---|
| PubChem CID | 87982067 |
| Molecular Formula | C26H31F3N4O4S |
| Molecular Weight | 552.62 g/mol |
| Exact Mass | 552.20 |
| IUPAC Name | (2R)-2-[cyanomethyl-[2,2,2-trifluoro-1-[4-(4-morpholin-2-ylsulfonylphenyl)phenyl]ethyl]amino]-4-methylpentanamide |
| SMILES | CC(C)C[C@H](C(N)=O)N(CC#N)C(c1ccc(-c2ccc(S(=O)(=O)C3CNCCO3)cc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C26H31F3N4O4S/c1-17(2)15-22(25(31)34)33(13-11-30)24(26(27,28)29)20-5-3-18(4-6-20)19-7-9-21(10-8-19)38(35,36)23-16-32-12-14-37-23/h3-10,17,22-24,32H,12-16H2,1-2H3,(H2,31,34)/t22-,23?,24?/m1/s1 |
| InChIKey | CROWHDPLBAZGOT-ZKMFCFPVSA-N |
| XLogP | 3.40 |
| TPSA | 125.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.62 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|