About (Z)-2-nitrobut-2-enoic acid
(Z)-2-nitrobut-2-enoic acid (PubChem CID 87982125) has the molecular formula C4H5NO4
and a molecular weight of 131.09 g/mol. Its IUPAC name is (Z)-2-nitrobut-2-enoic acid.
Molecular Properties
| Compound Name | (Z)-2-nitrobut-2-enoic acid |
| PubChem CID | 87982125 |
| Molecular Formula | C4H5NO4 |
| Molecular Weight | 131.09 g/mol |
| Exact Mass | 131.02 |
| IUPAC Name | (Z)-2-nitrobut-2-enoic acid |
| SMILES | C/C=C(/C(=O)O)[N+](=O)[O-] |
| InChI | InChI=1S/C4H5NO4/c1-2-3(4(6)7)5(8)9/h2H,1H3,(H,6,7)/b3-2- |
| InChIKey | WTERXQXUTRDDKY-IHWYPQMZSA-N |
| XLogP | 0.25 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.09 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-nitrobut-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-nitrobut-2-enoic acid?
The IUPAC name of (Z)-2-nitrobut-2-enoic acid (CID 87982125) is (Z)-2-nitrobut-2-enoic acid.
What is the SMILES notation for (Z)-2-nitrobut-2-enoic acid?
The canonical SMILES for (Z)-2-nitrobut-2-enoic acid is C/C=C(/C(=O)O)[N+](=O)[O-].
What is the InChIKey of (Z)-2-nitrobut-2-enoic acid?
The InChIKey is WTERXQXUTRDDKY-IHWYPQMZSA-N. The full InChI is InChI=1S/C4H5NO4/c1-2-3(4(6)7)5(8)9/h2H,1H3,(H,6,7)/b3-2-.
What are the key properties of (Z)-2-nitrobut-2-enoic acid?
(Z)-2-nitrobut-2-enoic acid has a molecular weight of 131.09 g/mol, XLogP of 0.25, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-nitrobut-2-enoic acid is sourced from PubChem (CID 87982125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).