About N,N'-dimethyl-N,N'-bis(sulfanyl)butanediamide
N,N'-dimethyl-N,N'-bis(sulfanyl)butanediamide (PubChem CID 87982217) has the molecular formula C6H12N2O2S2
and a molecular weight of 208.31 g/mol. Its IUPAC name is N,N'-dimethyl-N,N'-bis(sulfanyl)butanediamide.
Molecular Properties
| Compound Name | N,N'-dimethyl-N,N'-bis(sulfanyl)butanediamide |
| PubChem CID | 87982217 |
| Molecular Formula | C6H12N2O2S2 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | N,N'-dimethyl-N,N'-bis(sulfanyl)butanediamide |
| SMILES | CN(S)C(=O)CCC(=O)N(C)S |
| InChI | InChI=1S/C6H12N2O2S2/c1-7(11)5(9)3-4-6(10)8(2)12/h11-12H,3-4H2,1-2H3 |
| InChIKey | BTNDPUKPTJSCSU-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 40.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze N,N'-dimethyl-N,N'-bis(sulfanyl)butanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-dimethyl-N,N'-bis(sulfanyl)butanediamide?
The IUPAC name of N,N'-dimethyl-N,N'-bis(sulfanyl)butanediamide (CID 87982217) is N,N'-dimethyl-N,N'-bis(sulfanyl)butanediamide.
What is the SMILES notation for N,N'-dimethyl-N,N'-bis(sulfanyl)butanediamide?
The canonical SMILES for N,N'-dimethyl-N,N'-bis(sulfanyl)butanediamide is CN(S)C(=O)CCC(=O)N(C)S.
What is the InChIKey of N,N'-dimethyl-N,N'-bis(sulfanyl)butanediamide?
The InChIKey is BTNDPUKPTJSCSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O2S2/c1-7(11)5(9)3-4-6(10)8(2)12/h11-12H,3-4H2,1-2H3.
What are the key properties of N,N'-dimethyl-N,N'-bis(sulfanyl)butanediamide?
N,N'-dimethyl-N,N'-bis(sulfanyl)butanediamide has a molecular weight of 208.31 g/mol, XLogP of 0.37, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-dimethyl-N,N'-bis(sulfanyl)butanediamide is sourced from PubChem (CID 87982217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).