C18H24F3N3O2SSi — CID 87982344
1-[2-methyl-4-(2-trimethylsilylpropan-2-yloxy)phenyl]-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]urea (PubChem CID 87982344) has the molecular formula C18H24F3N3O2SSi and a molecular weight of 431.56 g/mol. Its IUPAC name is 1-[2-methyl-4-(2-trimethylsilylpropan-2-yloxy)phenyl]-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]urea.
| Compound Name | 1-[2-methyl-4-(2-trimethylsilylpropan-2-yloxy)phenyl]-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]urea |
|---|---|
| PubChem CID | 87982344 |
| Molecular Formula | C18H24F3N3O2SSi |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 1-[2-methyl-4-(2-trimethylsilylpropan-2-yloxy)phenyl]-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]urea |
| SMILES | Cc1cc(OC(C)(C)[Si](C)(C)C)ccc1NC(=O)Nc1nc(C(F)(F)F)cs1 |
| InChI | InChI=1S/C18H24F3N3O2SSi/c1-11-9-12(26-17(2,3)28(4,5)6)7-8-13(11)22-15(25)24-16-23-14(10-27-16)18(19,20)21/h7-10H,1-6H3,(H2,22,23,24,25) |
| InChIKey | UXLAMHMMTWSKJP-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|