C7H8F6O5 — CID 87982830
[1,1,1-trifluoro-3-hydroperoxy-3-methyl-2-(trifluoromethyl)butan-2-yl] hydrogen carbonate (PubChem CID 87982830) has the molecular formula C7H8F6O5 and a molecular weight of 286.12 g/mol. Its IUPAC name is [1,1,1-trifluoro-3-hydroperoxy-3-methyl-2-(trifluoromethyl)butan-2-yl] hydrogen carbonate.
| Compound Name | [1,1,1-trifluoro-3-hydroperoxy-3-methyl-2-(trifluoromethyl)butan-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 87982830 |
| Molecular Formula | C7H8F6O5 |
| Molecular Weight | 286.12 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | [1,1,1-trifluoro-3-hydroperoxy-3-methyl-2-(trifluoromethyl)butan-2-yl] hydrogen carbonate |
| SMILES | CC(C)(OO)C(OC(=O)O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H8F6O5/c1-4(2,18-16)5(6(8,9)10,7(11,12)13)17-3(14)15/h16H,1-2H3,(H,14,15) |
| InChIKey | LXZDJQRYWQUOEZ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.12 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|