C12H19NO3S — CID 8798342
N-methoxy-N,2,3,5,6-pentamethylbenzenesulfonamide (PubChem CID 8798342) has the molecular formula C12H19NO3S and a molecular weight of 257.35 g/mol. Its IUPAC name is N-methoxy-N,2,3,5,6-pentamethylbenzenesulfonamide.
| Compound Name | N-methoxy-N,2,3,5,6-pentamethylbenzenesulfonamide |
|---|---|
| PubChem CID | 8798342 |
| Molecular Formula | C12H19NO3S |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | N-methoxy-N,2,3,5,6-pentamethylbenzenesulfonamide |
| SMILES | CON(C)S(=O)(=O)c1c(C)c(C)cc(C)c1C |
| InChI | InChI=1S/C12H19NO3S/c1-8-7-9(2)11(4)12(10(8)3)17(14,15)13(5)16-6/h7H,1-6H3 |
| InChIKey | MVLXOVKEUMCZCP-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|