C22H12F9N3O3 — CID 87983856
4-naphthalen-1-yl-8-(2,2,3,3,4,4,5,5,5-nonafluoropentanoyl)-2,4,8-triazatricyclo[5.2.1.02,6]dec-6-ene-3,5-dione (PubChem CID 87983856) has the molecular formula C22H12F9N3O3 and a molecular weight of 537.34 g/mol. Its IUPAC name is 4-naphthalen-1-yl-8-(2,2,3,3,4,4,5,5,5-nonafluoropentanoyl)-2,4,8-triazatricyclo[5.2.1.02,6]dec-6-ene-3,5-dione.
| Compound Name | 4-naphthalen-1-yl-8-(2,2,3,3,4,4,5,5,5-nonafluoropentanoyl)-2,4,8-triazatricyclo[5.2.1.02,6]dec-6-ene-3,5-dione |
|---|---|
| PubChem CID | 87983856 |
| Molecular Formula | C22H12F9N3O3 |
| Molecular Weight | 537.34 g/mol |
| Exact Mass | 537.07 |
| IUPAC Name | 4-naphthalen-1-yl-8-(2,2,3,3,4,4,5,5,5-nonafluoropentanoyl)-2,4,8-triazatricyclo[5.2.1.02,6]dec-6-ene-3,5-dione |
| SMILES | O=C1C2=C3CC(CN3C(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)N2C(=O)N1c1cccc2ccccc12 |
| InChI | InChI=1S/C22H12F9N3O3/c23-19(24,20(25,26)21(27,28)22(29,30)31)17(36)32-9-11-8-14(32)15-16(35)34(18(37)33(11)15)13-7-3-5-10-4-1-2-6-12(10)13/h1-7,11H,8-9H2 |
| InChIKey | XXOCKIMKPMRBMJ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.34 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|