C12F25N — CID 87984083
1,2,2,3,3,4,5,5,6,6-decafluoro-N-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-N,4-bis(trifluoromethyl)cyclohexan-1-amine (PubChem CID 87984083) has the molecular formula C12F25N and a molecular weight of 633.09 g/mol. Its IUPAC name is 1,2,2,3,3,4,5,5,6,6-decafluoro-N-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-N,4-bis(trifluoromethyl)cyclohexan-1-amine.
| Compound Name | 1,2,2,3,3,4,5,5,6,6-decafluoro-N-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-N,4-bis(trifluoromethyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 87984083 |
| Molecular Formula | C12F25N |
| Molecular Weight | 633.09 g/mol |
| Exact Mass | 632.96 |
| IUPAC Name | 1,2,2,3,3,4,5,5,6,6-decafluoro-N-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-N,4-bis(trifluoromethyl)cyclohexan-1-amine |
| SMILES | FC(F)(F)N(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C1(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C12F25N/c13-1(9(27,28)29)2(14,15)4(18,19)8(26,5(20,21)3(1,16)17)38(12(35,36)37)11(33,34)7(24,25)6(22,23)10(30,31)32 |
| InChIKey | PTVSGCYKFQKBRR-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.09 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|