About (2Z)-2-[(5-phenylfuran-2-yl)methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one
(2Z)-2-[(5-phenylfuran-2-yl)methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one (PubChem CID 879845) has the molecular formula C20H12N2O2S
and a molecular weight of 344.40 g/mol. Its IUPAC name is (2Z)-2-[(5-phenylfuran-2-yl)methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one.
Molecular Properties
| Compound Name | (2Z)-2-[(5-phenylfuran-2-yl)methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one |
| PubChem CID | 879845 |
| Molecular Formula | C20H12N2O2S |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | (2Z)-2-[(5-phenylfuran-2-yl)methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one |
| SMILES | O=c1/c(=C/c2ccc(-c3ccccc3)o2)sc2nc3ccccc3n12 |
| InChI | InChI=1S/C20H12N2O2S/c23-19-18(25-20-21-15-8-4-5-9-16(15)22(19)20)12-14-10-11-17(24-14)13-6-2-1-3-7-13/h1-12H/b18-12- |
| InChIKey | UQPLCZPLTFIOKZ-PDGQHHTCSA-N |
| XLogP | 3.72 |
| TPSA | 47.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2Z)-2-[(5-phenylfuran-2-yl)methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-[(5-phenylfuran-2-yl)methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one?
The IUPAC name of (2Z)-2-[(5-phenylfuran-2-yl)methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one (CID 879845) is (2Z)-2-[(5-phenylfuran-2-yl)methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one.
What is the SMILES notation for (2Z)-2-[(5-phenylfuran-2-yl)methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one?
The canonical SMILES for (2Z)-2-[(5-phenylfuran-2-yl)methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one is O=c1/c(=C/c2ccc(-c3ccccc3)o2)sc2nc3ccccc3n12.
What is the InChIKey of (2Z)-2-[(5-phenylfuran-2-yl)methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one?
The InChIKey is UQPLCZPLTFIOKZ-PDGQHHTCSA-N. The full InChI is InChI=1S/C20H12N2O2S/c23-19-18(25-20-21-15-8-4-5-9-16(15)22(19)20)12-14-10-11-17(24-14)13-6-2-1-3-7-13/h1-12H/b18-12-.
What are the key properties of (2Z)-2-[(5-phenylfuran-2-yl)methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one?
(2Z)-2-[(5-phenylfuran-2-yl)methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one has a molecular weight of 344.40 g/mol, XLogP of 3.72, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-[(5-phenylfuran-2-yl)methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one is sourced from PubChem (CID 879845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).