C16H18O2 — CID 87984576
(2E,4E,6E,8E)-3,7-dimethyl-9-(2H-pyran-2-yl)nona-2,4,6,8-tetraenal (PubChem CID 87984576) has the molecular formula C16H18O2 and a molecular weight of 242.32 g/mol. Its IUPAC name is (2E,4E,6E,8E)-3,7-dimethyl-9-(2H-pyran-2-yl)nona-2,4,6,8-tetraenal.
| Compound Name | (2E,4E,6E,8E)-3,7-dimethyl-9-(2H-pyran-2-yl)nona-2,4,6,8-tetraenal |
|---|---|
| PubChem CID | 87984576 |
| Molecular Formula | C16H18O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | (2E,4E,6E,8E)-3,7-dimethyl-9-(2H-pyran-2-yl)nona-2,4,6,8-tetraenal |
| SMILES | CC(/C=C/C=C(C)/C=C/C1C=CC=CO1)=C\C=O |
| InChI | InChI=1S/C16H18O2/c1-14(6-5-7-15(2)11-12-17)9-10-16-8-3-4-13-18-16/h3-13,16H,1-2H3/b7-5+,10-9+,14-6+,15-11+ |
| InChIKey | KTDMJJQDTQHRSW-IJMFGVFOSA-N |
| XLogP | 3.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|