C24H30 — CID 87984646
2-butyl-4-(3,5-dimethylphenyl)-5,6,7-trimethyl-1H-indene (PubChem CID 87984646) has the molecular formula C24H30 and a molecular weight of 318.50 g/mol. Its IUPAC name is 2-butyl-4-(3,5-dimethylphenyl)-5,6,7-trimethyl-1H-indene.
| Compound Name | 2-butyl-4-(3,5-dimethylphenyl)-5,6,7-trimethyl-1H-indene |
|---|---|
| PubChem CID | 87984646 |
| Molecular Formula | C24H30 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | 2-butyl-4-(3,5-dimethylphenyl)-5,6,7-trimethyl-1H-indene |
| SMILES | CCCCC1=Cc2c(c(C)c(C)c(C)c2-c2cc(C)cc(C)c2)C1 |
| InChI | InChI=1S/C24H30/c1-7-8-9-20-13-22-18(5)17(4)19(6)24(23(22)14-20)21-11-15(2)10-16(3)12-21/h10-12,14H,7-9,13H2,1-6H3 |
| InChIKey | SVGWXINDVFKGJZ-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |