C14H24N2O10 — CID 87985284
ethyl 2-[[(2S,3S,4S,5R)-6-[(2-ethoxy-2-oxoethyl)amino]-2,3,4,5-tetrahydroxy-6-oxohexanoyl]amino]acetate (PubChem CID 87985284) has the molecular formula C14H24N2O10 and a molecular weight of 380.35 g/mol. Its IUPAC name is ethyl 2-[[(2S,3S,4S,5R)-6-[(2-ethoxy-2-oxoethyl)amino]-2,3,4,5-tetrahydroxy-6-oxohexanoyl]amino]acetate.
| Compound Name | ethyl 2-[[(2S,3S,4S,5R)-6-[(2-ethoxy-2-oxoethyl)amino]-2,3,4,5-tetrahydroxy-6-oxohexanoyl]amino]acetate |
|---|---|
| PubChem CID | 87985284 |
| Molecular Formula | C14H24N2O10 |
| Molecular Weight | 380.35 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | ethyl 2-[[(2S,3S,4S,5R)-6-[(2-ethoxy-2-oxoethyl)amino]-2,3,4,5-tetrahydroxy-6-oxohexanoyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(=O)NCC(=O)OCC |
| InChI | InChI=1S/C14H24N2O10/c1-3-25-7(17)5-15-13(23)11(21)9(19)10(20)12(22)14(24)16-6-8(18)26-4-2/h9-12,19-22H,3-6H2,1-2H3,(H,15,23)(H,16,24)/t9-,10-,11-,12+/m0/s1 |
| InChIKey | KLWHPWCGHHPGSS-FIQHERPVSA-N |
| XLogP | -4.21 |
| TPSA | 191.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.35 |
| LogP ≤ 5 | -4.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |