About [2-[2-acetamido-5-(4-methylsulfonylphenyl)-1,3-thiazol-4-yl]phenyl] prop-2-enoate
[2-[2-acetamido-5-(4-methylsulfonylphenyl)-1,3-thiazol-4-yl]phenyl] prop-2-enoate (PubChem CID 87985554) has the molecular formula C21H18N2O5S2
and a molecular weight of 442.52 g/mol. Its IUPAC name is [2-[2-acetamido-5-(4-methylsulfonylphenyl)-1,3-thiazol-4-yl]phenyl] prop-2-enoate.
Molecular Properties
| Compound Name | [2-[2-acetamido-5-(4-methylsulfonylphenyl)-1,3-thiazol-4-yl]phenyl] prop-2-enoate |
| PubChem CID | 87985554 |
| Molecular Formula | C21H18N2O5S2 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.07 |
| IUPAC Name | [2-[2-acetamido-5-(4-methylsulfonylphenyl)-1,3-thiazol-4-yl]phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccccc1-c1nc(NC(C)=O)sc1-c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C21H18N2O5S2/c1-4-18(25)28-17-8-6-5-7-16(17)19-20(29-21(23-19)22-13(2)24)14-9-11-15(12-10-14)30(3,26)27/h4-12H,1H2,2-3H3,(H,22,23,24) |
| InChIKey | RAGQTCBSNHVUKI-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-[2-acetamido-5-(4-methylsulfonylphenyl)-1,3-thiazol-4-yl]phenyl] prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[2-acetamido-5-(4-methylsulfonylphenyl)-1,3-thiazol-4-yl]phenyl] prop-2-enoate?
The IUPAC name of [2-[2-acetamido-5-(4-methylsulfonylphenyl)-1,3-thiazol-4-yl]phenyl] prop-2-enoate (CID 87985554) is [2-[2-acetamido-5-(4-methylsulfonylphenyl)-1,3-thiazol-4-yl]phenyl] prop-2-enoate.
What is the SMILES notation for [2-[2-acetamido-5-(4-methylsulfonylphenyl)-1,3-thiazol-4-yl]phenyl] prop-2-enoate?
The canonical SMILES for [2-[2-acetamido-5-(4-methylsulfonylphenyl)-1,3-thiazol-4-yl]phenyl] prop-2-enoate is C=CC(=O)Oc1ccccc1-c1nc(NC(C)=O)sc1-c1ccc(S(C)(=O)=O)cc1.
What is the InChIKey of [2-[2-acetamido-5-(4-methylsulfonylphenyl)-1,3-thiazol-4-yl]phenyl] prop-2-enoate?
The InChIKey is RAGQTCBSNHVUKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18N2O5S2/c1-4-18(25)28-17-8-6-5-7-16(17)19-20(29-21(23-19)22-13(2)24)14-9-11-15(12-10-14)30(3,26)27/h4-12H,1H2,2-3H3,(H,22,23,24).
What are the key properties of [2-[2-acetamido-5-(4-methylsulfonylphenyl)-1,3-thiazol-4-yl]phenyl] prop-2-enoate?
[2-[2-acetamido-5-(4-methylsulfonylphenyl)-1,3-thiazol-4-yl]phenyl] prop-2-enoate has a molecular weight of 442.52 g/mol, XLogP of 3.93, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[2-acetamido-5-(4-methylsulfonylphenyl)-1,3-thiazol-4-yl]phenyl] prop-2-enoate is sourced from PubChem (CID 87985554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).