C16H15NO8S2 — CID 87985793
3-[(3-carboxyphenyl)sulfonylsulfamoyl]-2,4-dimethylbenzoic acid (PubChem CID 87985793) has the molecular formula C16H15NO8S2 and a molecular weight of 413.43 g/mol. Its IUPAC name is 3-[(3-carboxyphenyl)sulfonylsulfamoyl]-2,4-dimethylbenzoic acid.
| Compound Name | 3-[(3-carboxyphenyl)sulfonylsulfamoyl]-2,4-dimethylbenzoic acid |
|---|---|
| PubChem CID | 87985793 |
| Molecular Formula | C16H15NO8S2 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.02 |
| IUPAC Name | 3-[(3-carboxyphenyl)sulfonylsulfamoyl]-2,4-dimethylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)c(C)c1S(=O)(=O)NS(=O)(=O)c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C16H15NO8S2/c1-9-6-7-13(16(20)21)10(2)14(9)27(24,25)17-26(22,23)12-5-3-4-11(8-12)15(18)19/h3-8,17H,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | XQORNUWUJNCIDZ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 154.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |