About azane;prop-2-enylurea
azane;prop-2-enylurea (PubChem CID 87985882) has the molecular formula C4H11N3O
and a molecular weight of 117.15 g/mol. Its IUPAC name is azane;prop-2-enylurea.
Molecular Properties
| Compound Name | azane;prop-2-enylurea |
| PubChem CID | 87985882 |
| Molecular Formula | C4H11N3O |
| Molecular Weight | 117.15 g/mol |
| Exact Mass | 117.09 |
| IUPAC Name | azane;prop-2-enylurea |
| SMILES | C=CCNC(N)=O.N |
| InChI | InChI=1S/C4H8N2O.H3N/c1-2-3-6-4(5)7;/h2H,1,3H2,(H3,5,6,7);1H3 |
| InChIKey | KRFMGXLZRGGBBK-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.15 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze azane;prop-2-enylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;prop-2-enylurea?
The IUPAC name of azane;prop-2-enylurea (CID 87985882) is azane;prop-2-enylurea.
What is the SMILES notation for azane;prop-2-enylurea?
The canonical SMILES for azane;prop-2-enylurea is C=CCNC(N)=O.N.
What is the InChIKey of azane;prop-2-enylurea?
The InChIKey is KRFMGXLZRGGBBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N2O.H3N/c1-2-3-6-4(5)7;/h2H,1,3H2,(H3,5,6,7);1H3.
What are the key properties of azane;prop-2-enylurea?
azane;prop-2-enylurea has a molecular weight of 117.15 g/mol, XLogP of 0.00, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;prop-2-enylurea is sourced from PubChem (CID 87985882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).