About bis(3-cyclopenta-1,4-dien-1-ylpropoxy(trimethyl)silane);zirconium(2+)
bis(3-cyclopenta-1,4-dien-1-ylpropoxy(trimethyl)silane);zirconium(2+) (PubChem CID 87986691) has the molecular formula C22H38O2Si2Zr
and a molecular weight of 481.94 g/mol. Its IUPAC name is bis(3-cyclopenta-1,4-dien-1-ylpropoxy(trimethyl)silane);zirconium(2+).
Molecular Properties
| Compound Name | bis(3-cyclopenta-1,4-dien-1-ylpropoxy(trimethyl)silane);zirconium(2+) |
| PubChem CID | 87986691 |
| Molecular Formula | C22H38O2Si2Zr |
| Molecular Weight | 481.94 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | bis(3-cyclopenta-1,4-dien-1-ylpropoxy(trimethyl)silane);zirconium(2+) |
| SMILES | C[Si](C)(C)OCCCC1=[C-]CC=C1.C[Si](C)(C)OCCCC1=[C-]CC=C1.[Zr+2] |
| InChI | InChI=1S/2C11H19OSi.Zr/c2*1-13(2,3)12-10-6-9-11-7-4-5-8-11;/h2*4,7H,5-6,9-10H2,1-3H3;/q2*-1;+2 |
| InChIKey | YIOBPPHSLDBKTE-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 481.94 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(3-cyclopenta-1,4-dien-1-ylpropoxy(trimethyl)silane);zirconium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3-cyclopenta-1,4-dien-1-ylpropoxy(trimethyl)silane);zirconium(2+)?
The IUPAC name of bis(3-cyclopenta-1,4-dien-1-ylpropoxy(trimethyl)silane);zirconium(2+) (CID 87986691) is bis(3-cyclopenta-1,4-dien-1-ylpropoxy(trimethyl)silane);zirconium(2+).
What is the SMILES notation for bis(3-cyclopenta-1,4-dien-1-ylpropoxy(trimethyl)silane);zirconium(2+)?
The canonical SMILES for bis(3-cyclopenta-1,4-dien-1-ylpropoxy(trimethyl)silane);zirconium(2+) is C[Si](C)(C)OCCCC1=[C-]CC=C1.C[Si](C)(C)OCCCC1=[C-]CC=C1.[Zr+2].
What is the InChIKey of bis(3-cyclopenta-1,4-dien-1-ylpropoxy(trimethyl)silane);zirconium(2+)?
The InChIKey is YIOBPPHSLDBKTE-UHFFFAOYSA-N. The full InChI is InChI=1S/2C11H19OSi.Zr/c2*1-13(2,3)12-10-6-9-11-7-4-5-8-11;/h2*4,7H,5-6,9-10H2,1-3H3;/q2*-1;+2.
What are the key properties of bis(3-cyclopenta-1,4-dien-1-ylpropoxy(trimethyl)silane);zirconium(2+)?
bis(3-cyclopenta-1,4-dien-1-ylpropoxy(trimethyl)silane);zirconium(2+) has a molecular weight of 481.94 g/mol, XLogP of 6.61, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3-cyclopenta-1,4-dien-1-ylpropoxy(trimethyl)silane);zirconium(2+) is sourced from PubChem (CID 87986691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).