C14H12N2O6 — CID 87986717
dimethyl (2S,3S)-1-(1,3-dioxoisoindol-2-yl)aziridine-2,3-dicarboxylate (PubChem CID 87986717) has the molecular formula C14H12N2O6 and a molecular weight of 304.26 g/mol. Its IUPAC name is dimethyl (2S,3S)-1-(1,3-dioxoisoindol-2-yl)aziridine-2,3-dicarboxylate.
| Compound Name | dimethyl (2S,3S)-1-(1,3-dioxoisoindol-2-yl)aziridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 87986717 |
| Molecular Formula | C14H12N2O6 |
| Molecular Weight | 304.26 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | dimethyl (2S,3S)-1-(1,3-dioxoisoindol-2-yl)aziridine-2,3-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H](C(=O)OC)N1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C14H12N2O6/c1-21-13(19)9-10(14(20)22-2)15(9)16-11(17)7-5-3-4-6-8(7)12(16)18/h3-6,9-10H,1-2H3/t9-,10-/m0/s1 |
| InChIKey | XLVJVRIIBPDGBK-UWVGGRQHSA-N |
| XLogP | -0.40 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.26 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|