About 1-prop-2-enyl-1-(4-prop-1-en-2-ylhepta-1,6-dien-4-yl)hydrazine
1-prop-2-enyl-1-(4-prop-1-en-2-ylhepta-1,6-dien-4-yl)hydrazine (PubChem CID 87986751) has the molecular formula C13H22N2
and a molecular weight of 206.33 g/mol. Its IUPAC name is 1-prop-2-enyl-1-(4-prop-1-en-2-ylhepta-1,6-dien-4-yl)hydrazine.
Molecular Properties
| Compound Name | 1-prop-2-enyl-1-(4-prop-1-en-2-ylhepta-1,6-dien-4-yl)hydrazine |
| PubChem CID | 87986751 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 1-prop-2-enyl-1-(4-prop-1-en-2-ylhepta-1,6-dien-4-yl)hydrazine |
| SMILES | C=CCN(N)C(CC=C)(CC=C)C(=C)C |
| InChI | InChI=1S/C13H22N2/c1-6-9-13(10-7-2,12(4)5)15(14)11-8-3/h6-8H,1-4,9-11,14H2,5H3 |
| InChIKey | NPXIKKCTNYJYJU-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-prop-2-enyl-1-(4-prop-1-en-2-ylhepta-1,6-dien-4-yl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-prop-2-enyl-1-(4-prop-1-en-2-ylhepta-1,6-dien-4-yl)hydrazine?
The IUPAC name of 1-prop-2-enyl-1-(4-prop-1-en-2-ylhepta-1,6-dien-4-yl)hydrazine (CID 87986751) is 1-prop-2-enyl-1-(4-prop-1-en-2-ylhepta-1,6-dien-4-yl)hydrazine.
What is the SMILES notation for 1-prop-2-enyl-1-(4-prop-1-en-2-ylhepta-1,6-dien-4-yl)hydrazine?
The canonical SMILES for 1-prop-2-enyl-1-(4-prop-1-en-2-ylhepta-1,6-dien-4-yl)hydrazine is C=CCN(N)C(CC=C)(CC=C)C(=C)C.
What is the InChIKey of 1-prop-2-enyl-1-(4-prop-1-en-2-ylhepta-1,6-dien-4-yl)hydrazine?
The InChIKey is NPXIKKCTNYJYJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2/c1-6-9-13(10-7-2,12(4)5)15(14)11-8-3/h6-8H,1-4,9-11,14H2,5H3.
What are the key properties of 1-prop-2-enyl-1-(4-prop-1-en-2-ylhepta-1,6-dien-4-yl)hydrazine?
1-prop-2-enyl-1-(4-prop-1-en-2-ylhepta-1,6-dien-4-yl)hydrazine has a molecular weight of 206.33 g/mol, XLogP of 2.82, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-prop-2-enyl-1-(4-prop-1-en-2-ylhepta-1,6-dien-4-yl)hydrazine is sourced from PubChem (CID 87986751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).