C20H28O3 — CID 87987422
4-(10-methylundecyl)-2-benzofuran-1,3-dione (PubChem CID 87987422) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is 4-(10-methylundecyl)-2-benzofuran-1,3-dione.
| Compound Name | 4-(10-methylundecyl)-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 87987422 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | 4-(10-methylundecyl)-2-benzofuran-1,3-dione |
| SMILES | CC(C)CCCCCCCCCc1cccc2c1C(=O)OC2=O |
| InChI | InChI=1S/C20H28O3/c1-15(2)11-8-6-4-3-5-7-9-12-16-13-10-14-17-18(16)20(22)23-19(17)21/h10,13-15H,3-9,11-12H2,1-2H3 |
| InChIKey | WIYCOWFHUUOKLZ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|