C17H17F3N2O4S — CID 87987446
3-[3-[[7-propyl-3-(trifluoromethyl)-2,1-benzoxazol-6-yl]oxy]propyl]-1,3-thiazolidine-2,4-dione (PubChem CID 87987446) has the molecular formula C17H17F3N2O4S and a molecular weight of 402.39 g/mol. Its IUPAC name is 3-[3-[[7-propyl-3-(trifluoromethyl)-2,1-benzoxazol-6-yl]oxy]propyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[3-[[7-propyl-3-(trifluoromethyl)-2,1-benzoxazol-6-yl]oxy]propyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 87987446 |
| Molecular Formula | C17H17F3N2O4S |
| Molecular Weight | 402.39 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | 3-[3-[[7-propyl-3-(trifluoromethyl)-2,1-benzoxazol-6-yl]oxy]propyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CCCc1c(OCCCN2C(=O)CSC2=O)ccc2c(C(F)(F)F)onc12 |
| InChI | InChI=1S/C17H17F3N2O4S/c1-2-4-10-12(25-8-3-7-22-13(23)9-27-16(22)24)6-5-11-14(10)21-26-15(11)17(18,19)20/h5-6H,2-4,7-9H2,1H3 |
| InChIKey | VFOAFEOHCSKNQF-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.39 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|