C22H6F26N2 — CID 87987734
2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-6-[6-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-2-pyridinyl]pyridine (PubChem CID 87987734) has the molecular formula C22H6F26N2 and a molecular weight of 792.25 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-6-[6-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-2-pyridinyl]pyridine.
| Compound Name | 2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-6-[6-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-2-pyridinyl]pyridine |
|---|---|
| PubChem CID | 87987734 |
| Molecular Formula | C22H6F26N2 |
| Molecular Weight | 792.25 g/mol |
| Exact Mass | 792.01 |
| IUPAC Name | 2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-6-[6-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-2-pyridinyl]pyridine |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)c1cccc(-c2cccc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)n2)n1 |
| InChI | InChI=1S/C22H6F26N2/c23-11(24,13(27,28)15(31,32)17(35,36)19(39,40)21(43,44)45)9-5-1-3-7(49-9)8-4-2-6-10(50-8)12(25,26)14(29,30)16(33,34)18(37,38)20(41,42)22(46,47)48/h1-6H |
| InChIKey | NCCMMRBARORZCG-UHFFFAOYSA-N |
| XLogP | 10.53 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.25 |
| LogP ≤ 5 | 10.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|