About oxolan-2-one;1,1,2,2-tetrachloroethene
oxolan-2-one;1,1,2,2-tetrachloroethene (PubChem CID 87987931) has the molecular formula C6H6Cl4O2
and a molecular weight of 251.92 g/mol. Its IUPAC name is oxolan-2-one;1,1,2,2-tetrachloroethene.
Molecular Properties
| Compound Name | oxolan-2-one;1,1,2,2-tetrachloroethene |
| PubChem CID | 87987931 |
| Molecular Formula | C6H6Cl4O2 |
| Molecular Weight | 251.92 g/mol |
| Exact Mass | 249.91 |
| IUPAC Name | oxolan-2-one;1,1,2,2-tetrachloroethene |
| SMILES | ClC(Cl)=C(Cl)Cl.O=C1CCCO1 |
| InChI | InChI=1S/C4H6O2.C2Cl4/c5-4-2-1-3-6-4;3-1(4)2(5)6/h1-3H2; |
| InChIKey | YGIURRBTUSJLAU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.92 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze oxolan-2-one;1,1,2,2-tetrachloroethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxolan-2-one;1,1,2,2-tetrachloroethene?
The IUPAC name of oxolan-2-one;1,1,2,2-tetrachloroethene (CID 87987931) is oxolan-2-one;1,1,2,2-tetrachloroethene.
What is the SMILES notation for oxolan-2-one;1,1,2,2-tetrachloroethene?
The canonical SMILES for oxolan-2-one;1,1,2,2-tetrachloroethene is ClC(Cl)=C(Cl)Cl.O=C1CCCO1.
What is the InChIKey of oxolan-2-one;1,1,2,2-tetrachloroethene?
The InChIKey is YGIURRBTUSJLAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O2.C2Cl4/c5-4-2-1-3-6-4;3-1(4)2(5)6/h1-3H2;.
What are the key properties of oxolan-2-one;1,1,2,2-tetrachloroethene?
oxolan-2-one;1,1,2,2-tetrachloroethene has a molecular weight of 251.92 g/mol, XLogP of 3.39, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for oxolan-2-one;1,1,2,2-tetrachloroethene is sourced from PubChem (CID 87987931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).