About [1-cyano-8,8-dimethyl-2-oxo-1-(triphenyl-λ5-phosphanylidene)nonan-3-yl]carbamic acid
[1-cyano-8,8-dimethyl-2-oxo-1-(triphenyl-λ5-phosphanylidene)nonan-3-yl]carbamic acid (PubChem CID 87987989) has the molecular formula C31H35N2O3P
and a molecular weight of 514.61 g/mol. Its IUPAC name is [1-cyano-8,8-dimethyl-2-oxo-1-(triphenyl-λ5-phosphanylidene)nonan-3-yl]carbamic acid.
Molecular Properties
| Compound Name | [1-cyano-8,8-dimethyl-2-oxo-1-(triphenyl-λ5-phosphanylidene)nonan-3-yl]carbamic acid |
| PubChem CID | 87987989 |
| Molecular Formula | C31H35N2O3P |
| Molecular Weight | 514.61 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | [1-cyano-8,8-dimethyl-2-oxo-1-(triphenyl-λ5-phosphanylidene)nonan-3-yl]carbamic acid |
| SMILES | CC(C)(C)CCCCC(NC(=O)O)C(=O)C(C#N)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H35N2O3P/c1-31(2,3)22-14-13-21-27(33-30(35)36)29(34)28(23-32)37(24-15-7-4-8-16-24,25-17-9-5-10-18-25)26-19-11-6-12-20-26/h4-12,15-20,27,33H,13-14,21-22H2,1-3H3,(H,35,36) |
| InChIKey | KHHYDCYCCKRZIR-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 514.61 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [1-cyano-8,8-dimethyl-2-oxo-1-(triphenyl-λ5-phosphanylidene)nonan-3-yl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-cyano-8,8-dimethyl-2-oxo-1-(triphenyl-λ5-phosphanylidene)nonan-3-yl]carbamic acid?
The IUPAC name of [1-cyano-8,8-dimethyl-2-oxo-1-(triphenyl-λ5-phosphanylidene)nonan-3-yl]carbamic acid (CID 87987989) is [1-cyano-8,8-dimethyl-2-oxo-1-(triphenyl-λ5-phosphanylidene)nonan-3-yl]carbamic acid.
What is the SMILES notation for [1-cyano-8,8-dimethyl-2-oxo-1-(triphenyl-λ5-phosphanylidene)nonan-3-yl]carbamic acid?
The canonical SMILES for [1-cyano-8,8-dimethyl-2-oxo-1-(triphenyl-λ5-phosphanylidene)nonan-3-yl]carbamic acid is CC(C)(C)CCCCC(NC(=O)O)C(=O)C(C#N)=P(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of [1-cyano-8,8-dimethyl-2-oxo-1-(triphenyl-λ5-phosphanylidene)nonan-3-yl]carbamic acid?
The InChIKey is KHHYDCYCCKRZIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H35N2O3P/c1-31(2,3)22-14-13-21-27(33-30(35)36)29(34)28(23-32)37(24-15-7-4-8-16-24,25-17-9-5-10-18-25)26-19-11-6-12-20-26/h4-12,15-20,27,33H,13-14,21-22H2,1-3H3,(H,35,36).
What are the key properties of [1-cyano-8,8-dimethyl-2-oxo-1-(triphenyl-λ5-phosphanylidene)nonan-3-yl]carbamic acid?
[1-cyano-8,8-dimethyl-2-oxo-1-(triphenyl-λ5-phosphanylidene)nonan-3-yl]carbamic acid has a molecular weight of 514.61 g/mol, XLogP of 5.49, 10 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-cyano-8,8-dimethyl-2-oxo-1-(triphenyl-λ5-phosphanylidene)nonan-3-yl]carbamic acid is sourced from PubChem (CID 87987989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).