C22H13ClFN7O4 — CID 87988590
4-[5-[(E)-[[6-(3-chloro-4-fluoroanilino)-[1,2,5]oxadiazolo[3,4-b]pyrazin-5-yl]hydrazinylidene]methyl]furan-2-yl]benzoic acid (PubChem CID 87988590) has the molecular formula C22H13ClFN7O4 and a molecular weight of 493.84 g/mol. Its IUPAC name is 4-[5-[(E)-[[6-(3-chloro-4-fluoroanilino)-[1,2,5]oxadiazolo[3,4-b]pyrazin-5-yl]hydrazinylidene]methyl]furan-2-yl]benzoic acid.
| Compound Name | 4-[5-[(E)-[[6-(3-chloro-4-fluoroanilino)-[1,2,5]oxadiazolo[3,4-b]pyrazin-5-yl]hydrazinylidene]methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 87988590 |
| Molecular Formula | C22H13ClFN7O4 |
| Molecular Weight | 493.84 g/mol |
| Exact Mass | 493.07 |
| IUPAC Name | 4-[5-[(E)-[[6-(3-chloro-4-fluoroanilino)-[1,2,5]oxadiazolo[3,4-b]pyrazin-5-yl]hydrazinylidene]methyl]furan-2-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2ccc(/C=N/Nc3nc4nonc4nc3Nc3ccc(F)c(Cl)c3)o2)cc1 |
| InChI | InChI=1S/C22H13ClFN7O4/c23-15-9-13(5-7-16(15)24)26-18-19(28-21-20(27-18)30-35-31-21)29-25-10-14-6-8-17(34-14)11-1-3-12(4-2-11)22(32)33/h1-10H,(H,32,33)(H,26,27,30)(H,28,29,31)/b25-10+ |
| InChIKey | DSYODOCVSQNEAB-KIBLKLHPSA-N |
| XLogP | 4.95 |
| TPSA | 151.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.84 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|