C22H31N3O8 — CID 87989039
carboxy 5-aminohexanoate;1-[[4-(2,5-dioxopyrrolidin-1-yl)cyclohexyl]methyl]pyrrole-2,5-dione (PubChem CID 87989039) has the molecular formula C22H31N3O8 and a molecular weight of 465.50 g/mol. Its IUPAC name is carboxy 5-aminohexanoate;1-[[4-(2,5-dioxopyrrolidin-1-yl)cyclohexyl]methyl]pyrrole-2,5-dione.
| Compound Name | carboxy 5-aminohexanoate;1-[[4-(2,5-dioxopyrrolidin-1-yl)cyclohexyl]methyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 87989039 |
| Molecular Formula | C22H31N3O8 |
| Molecular Weight | 465.50 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | carboxy 5-aminohexanoate;1-[[4-(2,5-dioxopyrrolidin-1-yl)cyclohexyl]methyl]pyrrole-2,5-dione |
| SMILES | CC(N)CCCC(=O)OC(=O)O.O=C1C=CC(=O)N1CC1CCC(N2C(=O)CCC2=O)CC1 |
| InChI | InChI=1S/C15H18N2O4.C7H13NO4/c18-12-5-6-13(19)16(12)9-10-1-3-11(4-2-10)17-14(20)7-8-15(17)21;1-5(8)3-2-4-6(9)12-7(10)11/h5-6,10-11H,1-4,7-9H2;5H,2-4,8H2,1H3,(H,10,11) |
| InChIKey | JJIRJMARFLMTCI-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 164.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.50 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|