About 1,2-difluoro-4-isocyanatobenzene;1,2,3-trifluoro-4-isocyanatobenzene
1,2-difluoro-4-isocyanatobenzene;1,2,3-trifluoro-4-isocyanatobenzene (PubChem CID 87989114) has the molecular formula C14H5F5N2O2
and a molecular weight of 328.20 g/mol. Its IUPAC name is 1,2-difluoro-4-isocyanatobenzene;1,2,3-trifluoro-4-isocyanatobenzene.
Molecular Properties
| Compound Name | 1,2-difluoro-4-isocyanatobenzene;1,2,3-trifluoro-4-isocyanatobenzene |
| PubChem CID | 87989114 |
| Molecular Formula | C14H5F5N2O2 |
| Molecular Weight | 328.20 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | 1,2-difluoro-4-isocyanatobenzene;1,2,3-trifluoro-4-isocyanatobenzene |
| SMILES | O=C=Nc1ccc(F)c(F)c1.O=C=Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C7H2F3NO.C7H3F2NO/c8-4-1-2-5(11-3-12)7(10)6(4)9;8-6-2-1-5(10-4-11)3-7(6)9/h1-2H;1-3H |
| InChIKey | IWTOWLARAFVVAF-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.20 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 1,2-difluoro-4-isocyanatobenzene;1,2,3-trifluoro-4-isocyanatobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-difluoro-4-isocyanatobenzene;1,2,3-trifluoro-4-isocyanatobenzene?
The IUPAC name of 1,2-difluoro-4-isocyanatobenzene;1,2,3-trifluoro-4-isocyanatobenzene (CID 87989114) is 1,2-difluoro-4-isocyanatobenzene;1,2,3-trifluoro-4-isocyanatobenzene.
What is the SMILES notation for 1,2-difluoro-4-isocyanatobenzene;1,2,3-trifluoro-4-isocyanatobenzene?
The canonical SMILES for 1,2-difluoro-4-isocyanatobenzene;1,2,3-trifluoro-4-isocyanatobenzene is O=C=Nc1ccc(F)c(F)c1.O=C=Nc1ccc(F)c(F)c1F.
What is the InChIKey of 1,2-difluoro-4-isocyanatobenzene;1,2,3-trifluoro-4-isocyanatobenzene?
The InChIKey is IWTOWLARAFVVAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H2F3NO.C7H3F2NO/c8-4-1-2-5(11-3-12)7(10)6(4)9;8-6-2-1-5(10-4-11)3-7(6)9/h1-2H;1-3H.
What are the key properties of 1,2-difluoro-4-isocyanatobenzene;1,2,3-trifluoro-4-isocyanatobenzene?
1,2-difluoro-4-isocyanatobenzene;1,2,3-trifluoro-4-isocyanatobenzene has a molecular weight of 328.20 g/mol, XLogP of 4.00, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-difluoro-4-isocyanatobenzene;1,2,3-trifluoro-4-isocyanatobenzene is sourced from PubChem (CID 87989114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).