About (E)-3-(1-methylcyclohexa-2,4-dien-1-yl)prop-2-enal
(E)-3-(1-methylcyclohexa-2,4-dien-1-yl)prop-2-enal (PubChem CID 87989743) has the molecular formula C10H12O
and a molecular weight of 148.20 g/mol. Its IUPAC name is (E)-3-(1-methylcyclohexa-2,4-dien-1-yl)prop-2-enal.
Molecular Properties
| Compound Name | (E)-3-(1-methylcyclohexa-2,4-dien-1-yl)prop-2-enal |
| PubChem CID | 87989743 |
| Molecular Formula | C10H12O |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | (E)-3-(1-methylcyclohexa-2,4-dien-1-yl)prop-2-enal |
| SMILES | CC1(/C=C/C=O)C=CC=CC1 |
| InChI | InChI=1S/C10H12O/c1-10(8-5-9-11)6-3-2-4-7-10/h2-6,8-9H,7H2,1H3/b8-5+ |
| InChIKey | GKMLIUDOIYSNBO-VMPITWQZSA-N |
| XLogP | 2.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-(1-methylcyclohexa-2,4-dien-1-yl)prop-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-(1-methylcyclohexa-2,4-dien-1-yl)prop-2-enal?
The IUPAC name of (E)-3-(1-methylcyclohexa-2,4-dien-1-yl)prop-2-enal (CID 87989743) is (E)-3-(1-methylcyclohexa-2,4-dien-1-yl)prop-2-enal.
What is the SMILES notation for (E)-3-(1-methylcyclohexa-2,4-dien-1-yl)prop-2-enal?
The canonical SMILES for (E)-3-(1-methylcyclohexa-2,4-dien-1-yl)prop-2-enal is CC1(/C=C/C=O)C=CC=CC1.
What is the InChIKey of (E)-3-(1-methylcyclohexa-2,4-dien-1-yl)prop-2-enal?
The InChIKey is GKMLIUDOIYSNBO-VMPITWQZSA-N. The full InChI is InChI=1S/C10H12O/c1-10(8-5-9-11)6-3-2-4-7-10/h2-6,8-9H,7H2,1H3/b8-5+.
What are the key properties of (E)-3-(1-methylcyclohexa-2,4-dien-1-yl)prop-2-enal?
(E)-3-(1-methylcyclohexa-2,4-dien-1-yl)prop-2-enal has a molecular weight of 148.20 g/mol, XLogP of 2.26, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(1-methylcyclohexa-2,4-dien-1-yl)prop-2-enal is sourced from PubChem (CID 87989743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).