About trichloro(3-chloropropyl)silane;trichloro(octyl)silane
trichloro(3-chloropropyl)silane;trichloro(octyl)silane (PubChem CID 87989801) has the molecular formula C11H23Cl7Si2
and a molecular weight of 459.65 g/mol. Its IUPAC name is trichloro(3-chloropropyl)silane;trichloro(octyl)silane.
Molecular Properties
| Compound Name | trichloro(3-chloropropyl)silane;trichloro(octyl)silane |
| PubChem CID | 87989801 |
| Molecular Formula | C11H23Cl7Si2 |
| Molecular Weight | 459.65 g/mol |
| Exact Mass | 455.92 |
| IUPAC Name | trichloro(3-chloropropyl)silane;trichloro(octyl)silane |
| SMILES | CCCCCCCC[Si](Cl)(Cl)Cl.ClCCC[Si](Cl)(Cl)Cl |
| InChI | InChI=1S/C8H17Cl3Si.C3H6Cl4Si/c1-2-3-4-5-6-7-8-12(9,10)11;4-2-1-3-8(5,6)7/h2-8H2,1H3;1-3H2 |
| InChIKey | PINLJZQEBCOHQG-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 459.65 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze trichloro(3-chloropropyl)silane;trichloro(octyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trichloro(3-chloropropyl)silane;trichloro(octyl)silane?
The IUPAC name of trichloro(3-chloropropyl)silane;trichloro(octyl)silane (CID 87989801) is trichloro(3-chloropropyl)silane;trichloro(octyl)silane.
What is the SMILES notation for trichloro(3-chloropropyl)silane;trichloro(octyl)silane?
The canonical SMILES for trichloro(3-chloropropyl)silane;trichloro(octyl)silane is CCCCCCCC[Si](Cl)(Cl)Cl.ClCCC[Si](Cl)(Cl)Cl.
What is the InChIKey of trichloro(3-chloropropyl)silane;trichloro(octyl)silane?
The InChIKey is PINLJZQEBCOHQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17Cl3Si.C3H6Cl4Si/c1-2-3-4-5-6-7-8-12(9,10)11;4-2-1-3-8(5,6)7/h2-8H2,1H3;1-3H2.
What are the key properties of trichloro(3-chloropropyl)silane;trichloro(octyl)silane?
trichloro(3-chloropropyl)silane;trichloro(octyl)silane has a molecular weight of 459.65 g/mol, XLogP of 8.27, 10 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trichloro(3-chloropropyl)silane;trichloro(octyl)silane is sourced from PubChem (CID 87989801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).